C15H13N5O3 — CID 110742560
N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazine-2-carboxamide (PubChem CID 110742560) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110742560 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazine-2-carboxamide |
| SMILES | CN1C(=O)NC(c2cccc(NC(=O)c3cnccn3)c2)C1=O |
| InChI | InChI=1S/C15H13N5O3/c1-20-14(22)12(19-15(20)23)9-3-2-4-10(7-9)18-13(21)11-8-16-5-6-17-11/h2-8,12H,1H3,(H,18,21)(H,19,23) |
| InChIKey | OKQOOMNNQXHMKV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|