About 1-(4-chlorophenyl)-2,2-difluoroethanol
1-(4-chlorophenyl)-2,2-difluoroethanol (PubChem CID 11074258) has the molecular formula C8H7ClF2O
and a molecular weight of 192.59 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,2-difluoroethanol |
| PubChem CID | 11074258 |
| Molecular Formula | C8H7ClF2O |
| Molecular Weight | 192.59 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2-difluoroethanol |
| SMILES | OC(c1ccc(Cl)cc1)C(F)F |
| InChI | InChI=1S/C8H7ClF2O/c9-6-3-1-5(2-4-6)7(12)8(10)11/h1-4,7-8,12H |
| InChIKey | JGZVFDXSUANZDW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,2-difluoroethanol?
The IUPAC name of 1-(4-chlorophenyl)-2,2-difluoroethanol (CID 11074258) is 1-(4-chlorophenyl)-2,2-difluoroethanol.
What is the SMILES notation for 1-(4-chlorophenyl)-2,2-difluoroethanol?
The canonical SMILES for 1-(4-chlorophenyl)-2,2-difluoroethanol is OC(c1ccc(Cl)cc1)C(F)F.
What is the InChIKey of 1-(4-chlorophenyl)-2,2-difluoroethanol?
The InChIKey is JGZVFDXSUANZDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF2O/c9-6-3-1-5(2-4-6)7(12)8(10)11/h1-4,7-8,12H.
What are the key properties of 1-(4-chlorophenyl)-2,2-difluoroethanol?
1-(4-chlorophenyl)-2,2-difluoroethanol has a molecular weight of 192.59 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,2-difluoroethanol is sourced from PubChem (CID 11074258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).