C11H18N2O — CID 11074295
(1R,4E,8S)-4-hydrazinylidenetricyclo[4.3.1.13,8]undecan-3-ol (PubChem CID 11074295) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (1R,4E,8S)-4-hydrazinylidenetricyclo[4.3.1.13,8]undecan-3-ol.
| Compound Name | (1R,4E,8S)-4-hydrazinylidenetricyclo[4.3.1.13,8]undecan-3-ol |
|---|---|
| PubChem CID | 11074295 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (1R,4E,8S)-4-hydrazinylidenetricyclo[4.3.1.13,8]undecan-3-ol |
| SMILES | N/N=C1\CC2C[C@@H]3C[C@H](C2)CC1(O)C3 |
| InChI | InChI=1S/C11H18N2O/c12-13-10-4-7-1-8-3-9(2-7)6-11(10,14)5-8/h7-9,14H,1-6,12H2/b13-10+/t7?,8-,9+,11? |
| InChIKey | NOIYYRJJCOYGOZ-SEYXPINJSA-N |
| XLogP | 1.26 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|