About [(E)-3,3-dimethylbut-1-enyl]-triethylsilane
[(E)-3,3-dimethylbut-1-enyl]-triethylsilane (PubChem CID 11074376) has the molecular formula C12H26Si
and a molecular weight of 198.43 g/mol. Its IUPAC name is [(E)-3,3-dimethylbut-1-enyl]-triethylsilane.
Molecular Properties
| Compound Name | [(E)-3,3-dimethylbut-1-enyl]-triethylsilane |
| PubChem CID | 11074376 |
| Molecular Formula | C12H26Si |
| Molecular Weight | 198.43 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | [(E)-3,3-dimethylbut-1-enyl]-triethylsilane |
| SMILES | CC[Si](/C=C/C(C)(C)C)(CC)CC |
| InChI | InChI=1S/C12H26Si/c1-7-13(8-2,9-3)11-10-12(4,5)6/h10-11H,7-9H2,1-6H3/b11-10+ |
| InChIKey | NMCXIZRJYSJQHC-ZHACJKMWSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3,3-dimethylbut-1-enyl]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3,3-dimethylbut-1-enyl]-triethylsilane?
The IUPAC name of [(E)-3,3-dimethylbut-1-enyl]-triethylsilane (CID 11074376) is [(E)-3,3-dimethylbut-1-enyl]-triethylsilane.
What is the SMILES notation for [(E)-3,3-dimethylbut-1-enyl]-triethylsilane?
The canonical SMILES for [(E)-3,3-dimethylbut-1-enyl]-triethylsilane is CC[Si](/C=C/C(C)(C)C)(CC)CC.
What is the InChIKey of [(E)-3,3-dimethylbut-1-enyl]-triethylsilane?
The InChIKey is NMCXIZRJYSJQHC-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H26Si/c1-7-13(8-2,9-3)11-10-12(4,5)6/h10-11H,7-9H2,1-6H3/b11-10+.
What are the key properties of [(E)-3,3-dimethylbut-1-enyl]-triethylsilane?
[(E)-3,3-dimethylbut-1-enyl]-triethylsilane has a molecular weight of 198.43 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3,3-dimethylbut-1-enyl]-triethylsilane is sourced from PubChem (CID 11074376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).