C14H17N5O3 — CID 110743774
1-methyl-3-[4-(pyrazine-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 110743774) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-methyl-3-[4-(pyrazine-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-[4-(pyrazine-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 110743774 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-methyl-3-[4-(pyrazine-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(N2CCN(C(=O)c3cnccn3)CC2)C1=O |
| InChI | InChI=1S/C14H17N5O3/c1-17-12(20)8-11(14(17)22)18-4-6-19(7-5-18)13(21)10-9-15-2-3-16-10/h2-3,9,11H,4-8H2,1H3 |
| InChIKey | PCHNQOQRWLSQME-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|