C9H20OSi2 — CID 11074423
cis-(2S,3R)-2,3-bis(trimethylsilyl)cyclopropan-1-one (PubChem CID 11074423) has the molecular formula C9H20OSi2 and a molecular weight of 200.43 g/mol. Its IUPAC name is cis-(2S,3R)-2,3-bis(trimethylsilyl)cyclopropan-1-one.
| Compound Name | cis-(2S,3R)-2,3-bis(trimethylsilyl)cyclopropan-1-one |
|---|---|
| PubChem CID | 11074423 |
| Molecular Formula | C9H20OSi2 |
| Molecular Weight | 200.43 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | cis-(2S,3R)-2,3-bis(trimethylsilyl)cyclopropan-1-one |
| SMILES | C[Si](C)(C)[C@@H]1C(=O)[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C9H20OSi2/c1-11(2,3)8-7(10)9(8)12(4,5)6/h8-9H,1-6H3/t8-,9+ |
| InChIKey | NHESVMBCDVPBOM-DTORHVGOSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|