C17H22N2O4 — CID 110745350
1-acetyl-N-[4-(1,3-dioxolan-2-yl)phenyl]piperidine-4-carboxamide (PubChem CID 110745350) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-acetyl-N-[4-(1,3-dioxolan-2-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[4-(1,3-dioxolan-2-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110745350 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-acetyl-N-[4-(1,3-dioxolan-2-yl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2ccc(C3OCCO3)cc2)CC1 |
| InChI | InChI=1S/C17H22N2O4/c1-12(20)19-8-6-13(7-9-19)16(21)18-15-4-2-14(3-5-15)17-22-10-11-23-17/h2-5,13,17H,6-11H2,1H3,(H,18,21) |
| InChIKey | NSULLNWRBXZOFX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |