C11H11N3O2 — CID 110745469
N-[2-(furan-2-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 110745469) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110745469 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCc1ccco1)c1cnccn1 |
| InChI | InChI=1S/C11H11N3O2/c15-11(10-8-12-5-6-13-10)14-4-3-9-2-1-7-16-9/h1-2,5-8H,3-4H2,(H,14,15) |
| InChIKey | ZGKAPAUNIXYPOB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |