C14H15N5O3 — CID 110745900
3-[4-(6-oxo-1H-pyridin-3-yl)piperazine-1-carbonyl]-1H-pyridazin-6-one (PubChem CID 110745900) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 3-[4-(6-oxo-1H-pyridin-3-yl)piperazine-1-carbonyl]-1H-pyridazin-6-one.
| Compound Name | 3-[4-(6-oxo-1H-pyridin-3-yl)piperazine-1-carbonyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 110745900 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[4-(6-oxo-1H-pyridin-3-yl)piperazine-1-carbonyl]-1H-pyridazin-6-one |
| SMILES | O=C(c1ccc(=O)[nH]n1)N1CCN(c2ccc(=O)[nH]c2)CC1 |
| InChI | InChI=1S/C14H15N5O3/c20-12-3-1-10(9-15-12)18-5-7-19(8-6-18)14(22)11-2-4-13(21)17-16-11/h1-4,9H,5-8H2,(H,15,20)(H,17,21) |
| InChIKey | LPUWOYPVOQCCNU-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |