C15H19N3O3 — CID 110746088
N-[2-[(1-methyl-5-oxopyrrolidin-3-yl)methylamino]-2-oxoethyl]benzamide (PubChem CID 110746088) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2-[(1-methyl-5-oxopyrrolidin-3-yl)methylamino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[(1-methyl-5-oxopyrrolidin-3-yl)methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110746088 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[2-[(1-methyl-5-oxopyrrolidin-3-yl)methylamino]-2-oxoethyl]benzamide |
| SMILES | CN1CC(CNC(=O)CNC(=O)c2ccccc2)CC1=O |
| InChI | InChI=1S/C15H19N3O3/c1-18-10-11(7-14(18)20)8-16-13(19)9-17-15(21)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H,16,19)(H,17,21) |
| InChIKey | JCCDTQRTOAXOKX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |