C9H15N3O2 — CID 110747518
1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propan-2-ylurea (PubChem CID 110747518) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propan-2-ylurea.
| Compound Name | 1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 110747518 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propan-2-ylurea |
| SMILES | Cc1cc(CNC(=O)NC(C)C)no1 |
| InChI | InChI=1S/C9H15N3O2/c1-6(2)11-9(13)10-5-8-4-7(3)14-12-8/h4,6H,5H2,1-3H3,(H2,10,11,13) |
| InChIKey | YKMVSOIBVQMCHA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |