C13H14O3 — CID 11074845
methyl (1R,5R)-5-ethynyl-7-methylidene-2-oxobicyclo[3.2.1]octane-1-carboxylate (PubChem CID 11074845) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl (1R,5R)-5-ethynyl-7-methylidene-2-oxobicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl (1R,5R)-5-ethynyl-7-methylidene-2-oxobicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 11074845 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | methyl (1R,5R)-5-ethynyl-7-methylidene-2-oxobicyclo[3.2.1]octane-1-carboxylate |
| SMILES | C#C[C@@]12CCC(=O)[C@@](C(=O)OC)(C1)C(=C)C2 |
| InChI | InChI=1S/C13H14O3/c1-4-12-6-5-10(14)13(8-12,9(2)7-12)11(15)16-3/h1H,2,5-8H2,3H3/t12-,13+/m0/s1 |
| InChIKey | ZGNUCZBLTWKHRZ-QWHCGFSZSA-N |
| XLogP | 1.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|