C15H20ClN3O2 — CID 110749341
1-(4-chlorophenyl)-3-[(5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl]urea (PubChem CID 110749341) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 110749341 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl]urea |
| SMILES | CC(C)N1CC(CNC(=O)Nc2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C15H20ClN3O2/c1-10(2)19-9-11(7-14(19)20)8-17-15(21)18-13-5-3-12(16)4-6-13/h3-6,10-11H,7-9H2,1-2H3,(H2,17,18,21) |
| InChIKey | KMSBUCCTBNURDU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |