About (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone
(5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone (PubChem CID 110750128) has the molecular formula C16H16BrNO2
and a molecular weight of 334.21 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone.
Molecular Properties
| Compound Name | (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone |
| PubChem CID | 110750128 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccc(Br)o2)Cc2ccccc21 |
| InChI | InChI=1S/C16H16BrNO2/c1-16(2)10-18(9-11-5-3-4-6-12(11)16)15(19)13-7-8-14(17)20-13/h3-8H,9-10H2,1-2H3 |
| InChIKey | UHTICUKTZVJNMH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone?
The IUPAC name of (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone (CID 110750128) is (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone.
What is the SMILES notation for (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone?
The canonical SMILES for (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone is CC1(C)CN(C(=O)c2ccc(Br)o2)Cc2ccccc21.
What is the InChIKey of (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone?
The InChIKey is UHTICUKTZVJNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNO2/c1-16(2)10-18(9-11-5-3-4-6-12(11)16)15(19)13-7-8-14(17)20-13/h3-8H,9-10H2,1-2H3.
What are the key properties of (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone?
(5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone has a molecular weight of 334.21 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromofuran-2-yl)-(4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)methanone is sourced from PubChem (CID 110750128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).