C17H16FNO2 — CID 110751156
N-(3,4-dihydro-2H-chromen-4-yl)-2-fluoro-N-methylbenzamide (PubChem CID 110751156) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-2-fluoro-N-methylbenzamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 110751156 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-2-fluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1F)C1CCOc2ccccc21 |
| InChI | InChI=1S/C17H16FNO2/c1-19(17(20)12-6-2-4-8-14(12)18)15-10-11-21-16-9-5-3-7-13(15)16/h2-9,15H,10-11H2,1H3 |
| InChIKey | RXYADBGOIWMTKX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |