C14H16N2O3S — CID 110752603
4-methoxy-N,3-dimethyl-N-pyridin-3-ylbenzenesulfonamide (PubChem CID 110752603) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-methoxy-N,3-dimethyl-N-pyridin-3-ylbenzenesulfonamide.
| Compound Name | 4-methoxy-N,3-dimethyl-N-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 110752603 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-methoxy-N,3-dimethyl-N-pyridin-3-ylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2cccnc2)cc1C |
| InChI | InChI=1S/C14H16N2O3S/c1-11-9-13(6-7-14(11)19-3)20(17,18)16(2)12-5-4-8-15-10-12/h4-10H,1-3H3 |
| InChIKey | SBHJSJJIPISGBU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |