About [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane
[4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane (PubChem CID 11075301) has the molecular formula C10H20S2Si
and a molecular weight of 232.49 g/mol. Its IUPAC name is [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane |
| PubChem CID | 11075301 |
| Molecular Formula | C10H20S2Si |
| Molecular Weight | 232.49 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane |
| SMILES | CSC1(SC)CC=C([Si](C)(C)C)C1 |
| InChI | InChI=1S/C10H20S2Si/c1-11-10(12-2)7-6-9(8-10)13(3,4)5/h6H,7-8H2,1-5H3 |
| InChIKey | JVZVLBMQMHLBSK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane?
The IUPAC name of [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane (CID 11075301) is [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane.
What is the SMILES notation for [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane?
The canonical SMILES for [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane is CSC1(SC)CC=C([Si](C)(C)C)C1.
What is the InChIKey of [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane?
The InChIKey is JVZVLBMQMHLBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20S2Si/c1-11-10(12-2)7-6-9(8-10)13(3,4)5/h6H,7-8H2,1-5H3.
What are the key properties of [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane?
[4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane has a molecular weight of 232.49 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-bis(methylsulfanyl)cyclopenten-1-yl]-trimethylsilane is sourced from PubChem (CID 11075301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).