C28H28FNO3 — CID 1107537
4-[[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]methyl]morpholine (PubChem CID 1107537) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is 4-[[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]methyl]morpholine.
| Compound Name | 4-[[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 1107537 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-[[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]methyl]morpholine |
| SMILES | CCOc1ccc(C2=C(CN3CCOCC3)[C@@H](c3ccc(F)cc3)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C28H28FNO3/c1-2-32-23-13-9-21(10-14-23)28-25(19-30-15-17-31-18-16-30)27(20-7-11-22(29)12-8-20)24-5-3-4-6-26(24)33-28/h3-14,27H,2,15-19H2,1H3/t27-/m0/s1 |
| InChIKey | SDILMVGNWPKUBF-MHZLTWQESA-N |
| XLogP | 5.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |