C15H14N2O2 — CID 110753861
2-(2,3-dihydro-1-benzofuran-3-yl)-N-pyridin-2-ylacetamide (PubChem CID 110753861) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-3-yl)-N-pyridin-2-ylacetamide.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-3-yl)-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 110753861 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-3-yl)-N-pyridin-2-ylacetamide |
| SMILES | O=C(CC1COc2ccccc21)Nc1ccccn1 |
| InChI | InChI=1S/C15H14N2O2/c18-15(17-14-7-3-4-8-16-14)9-11-10-19-13-6-2-1-5-12(11)13/h1-8,11H,9-10H2,(H,16,17,18) |
| InChIKey | OTHUPABGRDQYJZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |