C14H26N2O — CID 110754789
2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide (PubChem CID 110754789) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide.
| Compound Name | 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 110754789 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C14H26N2O/c1-3-15(4-2)14(17)11-12-7-9-16(10-8-12)13-5-6-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | DVKPXEFRLNMBDB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |