About 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide
2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide (PubChem CID 110754789) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide |
| PubChem CID | 110754789 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C14H26N2O/c1-3-15(4-2)14(17)11-12-7-9-16(10-8-12)13-5-6-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | DVKPXEFRLNMBDB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide?
The IUPAC name of 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide (CID 110754789) is 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide.
What is the SMILES notation for 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide?
The canonical SMILES for 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide is CCN(CC)C(=O)CC1CCN(C2CC2)CC1.
What is the InChIKey of 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide?
The InChIKey is DVKPXEFRLNMBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c1-3-15(4-2)14(17)11-12-7-9-16(10-8-12)13-5-6-13/h12-13H,3-11H2,1-2H3.
What are the key properties of 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide?
2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide has a molecular weight of 238.37 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopropylpiperidin-4-yl)-N,N-diethylacetamide is sourced from PubChem (CID 110754789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).