C9H13Cl2NO2 — CID 11075479
(4R,7R,11S)-7-chloro-5-oxa-1-azoniatricyclo[5.3.1.04,11]undecan-6-one chloride (PubChem CID 11075479) has the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. Its IUPAC name is (4R,7R,11S)-7-chloro-5-oxa-1-azoniatricyclo[5.3.1.04,11]undecan-6-one chloride.
| Compound Name | (4R,7R,11S)-7-chloro-5-oxa-1-azoniatricyclo[5.3.1.04,11]undecan-6-one chloride |
|---|---|
| PubChem CID | 11075479 |
| Molecular Formula | C9H13Cl2NO2 |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | (4R,7R,11S)-7-chloro-5-oxa-1-azoniatricyclo[5.3.1.04,11]undecan-6-one chloride |
| SMILES | O=C1O[C@@H]2CC[NH+]3CCC[C@@]1(Cl)[C@H]23.[Cl-] |
| InChI | InChI=1S/C9H12ClNO2.ClH/c10-9-3-1-4-11-5-2-6(7(9)11)13-8(9)12;/h6-7H,1-5H2;1H/t6-,7+,9-;/m1./s1 |
| InChIKey | YEPINNKGNVBMOL-GJRYXAKSSA-N |
| XLogP | -3.66 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|