About diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate
diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate (PubChem CID 11075489) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate |
| PubChem CID | 11075489 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)CC1=C |
| InChI | InChI=1S/C13H18O4/c1-5-16-11(14)13(12(15)17-6-2)7-9(3)10(4)8-13/h3-8H2,1-2H3 |
| InChIKey | RBKQNRNYZUDZKZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate?
The IUPAC name of diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate (CID 11075489) is diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate.
What is the SMILES notation for diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate?
The canonical SMILES for diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate is C=C1CC(C(=O)OCC)(C(=O)OCC)CC1=C.
What is the InChIKey of diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate?
The InChIKey is RBKQNRNYZUDZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-5-16-11(14)13(12(15)17-6-2)7-9(3)10(4)8-13/h3-8H2,1-2H3.
What are the key properties of diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate?
diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate has a molecular weight of 238.28 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3,4-dimethylidenecyclopentane-1,1-dicarboxylate is sourced from PubChem (CID 11075489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).