About (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol
(2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol (PubChem CID 11075535) has the molecular formula C15H29NO
and a molecular weight of 239.40 g/mol. Its IUPAC name is (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol |
| PubChem CID | 11075535 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol |
| SMILES | CCC/C=C/C=C/CNC[C@H](O)CCCCC |
| InChI | InChI=1S/C15H29NO/c1-3-5-7-8-9-11-13-16-14-15(17)12-10-6-4-2/h7-9,11,15-17H,3-6,10,12-14H2,1-2H3/b8-7+,11-9+/t15-/m1/s1 |
| InChIKey | IPGLKLMWYXMYAB-HNYVXQBRSA-N |
| XLogP | 3.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol?
The IUPAC name of (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol (CID 11075535) is (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol.
What is the SMILES notation for (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol?
The canonical SMILES for (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol is CCC/C=C/C=C/CNC[C@H](O)CCCCC.
What is the InChIKey of (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol?
The InChIKey is IPGLKLMWYXMYAB-HNYVXQBRSA-N. The full InChI is InChI=1S/C15H29NO/c1-3-5-7-8-9-11-13-16-14-15(17)12-10-6-4-2/h7-9,11,15-17H,3-6,10,12-14H2,1-2H3/b8-7+,11-9+/t15-/m1/s1.
What are the key properties of (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol?
(2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol has a molecular weight of 239.40 g/mol, XLogP of 3.43, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[[(2E,4E)-octa-2,4-dienyl]amino]heptan-2-ol is sourced from PubChem (CID 11075535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).