C17H24O — CID 11075693
(4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-ol (PubChem CID 11075693) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-ol.
| Compound Name | (4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-ol |
|---|---|
| PubChem CID | 11075693 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-ol |
| SMILES | CC1(C)CCC[C@]2(C)c3cccc(O)c3CC[C@@H]12 |
| InChI | InChI=1S/C17H24O/c1-16(2)10-5-11-17(3)13-6-4-7-14(18)12(13)8-9-15(16)17/h4,6-7,15,18H,5,8-11H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | INGVFHMUEKKXHO-DOTOQJQBSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |