C10H13Cl2NO2S — CID 110757016
N-(2,4-dichlorophenyl)butane-1-sulfonamide (PubChem CID 110757016) has the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)butane-1-sulfonamide.
| Compound Name | N-(2,4-dichlorophenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 110757016 |
| Molecular Formula | C10H13Cl2NO2S |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2S/c1-2-3-6-16(14,15)13-10-5-4-8(11)7-9(10)12/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | GAFRZJNTNYWFCV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |