C12H20ClNO2 — CID 11075727
(4S,4aR,8aS)-8a-(chloromethyl)-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-1H-benzo[d][1,3]oxazin-2-one (PubChem CID 11075727) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is (4S,4aR,8aS)-8a-(chloromethyl)-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-1H-benzo[d][1,3]oxazin-2-one.
| Compound Name | (4S,4aR,8aS)-8a-(chloromethyl)-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-1H-benzo[d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 11075727 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (4S,4aR,8aS)-8a-(chloromethyl)-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-1H-benzo[d][1,3]oxazin-2-one |
| SMILES | CC(C)[C@@H]1OC(=O)N[C@@]2(CCl)CCCC[C@@H]12 |
| InChI | InChI=1S/C12H20ClNO2/c1-8(2)10-9-5-3-4-6-12(9,7-13)14-11(15)16-10/h8-10H,3-7H2,1-2H3,(H,14,15)/t9-,10-,12+/m0/s1 |
| InChIKey | YLOLNOLICMUZOH-JBLDHEPKSA-N |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|