C16H20N2O3S — CID 110758191
3-methyl-N-(2-methyl-4-pyridinyl)-4-propan-2-yloxybenzenesulfonamide (PubChem CID 110758191) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-methyl-N-(2-methyl-4-pyridinyl)-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | 3-methyl-N-(2-methyl-4-pyridinyl)-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 110758191 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-methyl-N-(2-methyl-4-pyridinyl)-4-propan-2-yloxybenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(OC(C)C)c(C)c2)ccn1 |
| InChI | InChI=1S/C16H20N2O3S/c1-11(2)21-16-6-5-15(9-12(16)3)22(19,20)18-14-7-8-17-13(4)10-14/h5-11H,1-4H3,(H,17,18) |
| InChIKey | PLVAEQQQAXLUKD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |