C13H18FNO4S — CID 110758210
4-(3-fluoro-4-propan-2-yloxyphenyl)sulfonylmorpholine (PubChem CID 110758210) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-(3-fluoro-4-propan-2-yloxyphenyl)sulfonylmorpholine.
| Compound Name | 4-(3-fluoro-4-propan-2-yloxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 110758210 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-(3-fluoro-4-propan-2-yloxyphenyl)sulfonylmorpholine |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCOCC2)cc1F |
| InChI | InChI=1S/C13H18FNO4S/c1-10(2)19-13-4-3-11(9-12(13)14)20(16,17)15-5-7-18-8-6-15/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | JZUATPFHUNXDSV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |