C17H22N2O3S — CID 110759535
2-methoxy-N,4,6-trimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide (PubChem CID 110759535) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-methoxy-N,4,6-trimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide.
| Compound Name | 2-methoxy-N,4,6-trimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110759535 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-methoxy-N,4,6-trimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
| SMILES | COc1cc(C)cc(C)c1S(=O)(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-13-11-14(2)17(16(12-13)22-4)23(20,21)19(3)10-7-15-5-8-18-9-6-15/h5-6,8-9,11-12H,7,10H2,1-4H3 |
| InChIKey | ZAGKEDWRBDVLSL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |