C16H15NO2 — CID 11075981
(3R,3aS,9bR)-3-phenyl-3,3a,4,9b-tetrahydro-1H-chromeno[4,3-c][1,2]oxazole (PubChem CID 11075981) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (3R,3aS,9bR)-3-phenyl-3,3a,4,9b-tetrahydro-1H-chromeno[4,3-c][1,2]oxazole.
| Compound Name | (3R,3aS,9bR)-3-phenyl-3,3a,4,9b-tetrahydro-1H-chromeno[4,3-c][1,2]oxazole |
|---|---|
| PubChem CID | 11075981 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3R,3aS,9bR)-3-phenyl-3,3a,4,9b-tetrahydro-1H-chromeno[4,3-c][1,2]oxazole |
| SMILES | c1ccc([C@@H]2ON[C@H]3c4ccccc4OC[C@H]32)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-2-6-11(7-3-1)16-13-10-18-14-9-5-4-8-12(14)15(13)17-19-16/h1-9,13,15-17H,10H2/t13-,15+,16+/m1/s1 |
| InChIKey | GWKSMCSMCCFHGC-KBMXLJTQSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |