C13H18O5 — CID 11075991
[(3aS,4R,7R,7aS)-4-(methoxymethyl)-6-methyl-3-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl] acetate (PubChem CID 11075991) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is [(3aS,4R,7R,7aS)-4-(methoxymethyl)-6-methyl-3-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl] acetate.
| Compound Name | [(3aS,4R,7R,7aS)-4-(methoxymethyl)-6-methyl-3-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl] acetate |
|---|---|
| PubChem CID | 11075991 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [(3aS,4R,7R,7aS)-4-(methoxymethyl)-6-methyl-3-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl] acetate |
| SMILES | COC[C@@H]1C=C(C)[C@@H](OC(C)=O)[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C13H18O5/c1-7-4-9(5-16-3)11-10(15)6-17-13(11)12(7)18-8(2)14/h4,9,11-13H,5-6H2,1-3H3/t9-,11+,12+,13-/m0/s1 |
| InChIKey | MERLETUYYYNHLO-SQNXGDPESA-N |
| XLogP | 0.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|