C15H15N3O4S — CID 110760043
N-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-sulfonamide (PubChem CID 110760043) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760043 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc3nc[nH]c3c2)cc1OC |
| InChI | InChI=1S/C15H15N3O4S/c1-21-14-6-3-10(7-15(14)22-2)18-23(19,20)11-4-5-12-13(8-11)17-9-16-12/h3-9,18H,1-2H3,(H,16,17) |
| InChIKey | VKEWMRZIKPRMIB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |