C15H12N4O2S — CID 110760223
N-(4-cyanophenyl)-2-methyl-3H-benzimidazole-5-sulfonamide (PubChem CID 110760223) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-methyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-(4-cyanophenyl)-2-methyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760223 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-(4-cyanophenyl)-2-methyl-3H-benzimidazole-5-sulfonamide |
| SMILES | Cc1nc2ccc(S(=O)(=O)Nc3ccc(C#N)cc3)cc2[nH]1 |
| InChI | InChI=1S/C15H12N4O2S/c1-10-17-14-7-6-13(8-15(14)18-10)22(20,21)19-12-4-2-11(9-16)3-5-12/h2-8,19H,1H3,(H,17,18) |
| InChIKey | LTNNRHNIFMGDGQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |