C13H19N3O2S — CID 110760294
N-butyl-N,1-dimethylbenzimidazole-5-sulfonamide (PubChem CID 110760294) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-butyl-N,1-dimethylbenzimidazole-5-sulfonamide.
| Compound Name | N-butyl-N,1-dimethylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760294 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-butyl-N,1-dimethylbenzimidazole-5-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C13H19N3O2S/c1-4-5-8-16(3)19(17,18)11-6-7-13-12(9-11)14-10-15(13)2/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | LFRNULIXKLZIOK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |