About 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole
2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole (PubChem CID 11076091) has the molecular formula C16H13F2N
and a molecular weight of 257.28 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 11076091 |
| Molecular Formula | C16H13F2N |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1cccc(F)c1C1CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C16H13F2N/c17-12-7-4-8-13(18)16(12)15-10-9-14(19-15)11-5-2-1-3-6-11/h1-8,15H,9-10H2 |
| InChIKey | POVWKLUYGDHFDJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole (CID 11076091) is 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole is Fc1cccc(F)c1C1CCC(c2ccccc2)=N1.
What is the InChIKey of 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole?
The InChIKey is POVWKLUYGDHFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2N/c17-12-7-4-8-13(18)16(12)15-10-9-14(19-15)11-5-2-1-3-6-11/h1-8,15H,9-10H2.
What are the key properties of 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole?
2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole has a molecular weight of 257.28 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 11076091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).