About 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol
2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol (PubChem CID 11076105) has the molecular formula C15H15NOS
and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol.
Molecular Properties
| Compound Name | 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol |
| PubChem CID | 11076105 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol |
| SMILES | C=C=C(C)C(O)(c1ccccc1)c1nc(C)cs1 |
| InChI | InChI=1S/C15H15NOS/c1-4-11(2)15(17,13-8-6-5-7-9-13)14-16-12(3)10-18-14/h5-10,17H,1H2,2-3H3 |
| InChIKey | YDDAQMQYJCQATM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol?
The IUPAC name of 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol (CID 11076105) is 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol.
What is the SMILES notation for 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol?
The canonical SMILES for 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol is C=C=C(C)C(O)(c1ccccc1)c1nc(C)cs1.
What is the InChIKey of 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol?
The InChIKey is YDDAQMQYJCQATM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NOS/c1-4-11(2)15(17,13-8-6-5-7-9-13)14-16-12(3)10-18-14/h5-10,17H,1H2,2-3H3.
What are the key properties of 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol?
2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol has a molecular weight of 257.36 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(4-methyl-1,3-thiazol-2-yl)-1-phenylbuta-2,3-dien-1-ol is sourced from PubChem (CID 11076105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).