C16H23BO2 — CID 11076114
4,4,5,5-tetramethyl-2-[(E)-4-phenylbut-1-enyl]-1,3,2-dioxaborolane (PubChem CID 11076114) has the molecular formula C16H23BO2 and a molecular weight of 258.17 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-4-phenylbut-1-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-4-phenylbut-1-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11076114 |
| Molecular Formula | C16H23BO2 |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-4-phenylbut-1-enyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C=C/CCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C16H23BO2/c1-15(2)16(3,4)19-17(18-15)13-9-8-12-14-10-6-5-7-11-14/h5-7,9-11,13H,8,12H2,1-4H3/b13-9+ |
| InChIKey | XMYNGYPSTGHXEL-UKTHLTGXSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|