C17H26N2O2 — CID 110761648
(4-ethoxy-2,5-dimethylphenyl)-(4-ethylpiperazin-1-yl)methanone (PubChem CID 110761648) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (4-ethoxy-2,5-dimethylphenyl)-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | (4-ethoxy-2,5-dimethylphenyl)-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110761648 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (4-ethoxy-2,5-dimethylphenyl)-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCOc1cc(C)c(C(=O)N2CCN(CC)CC2)cc1C |
| InChI | InChI=1S/C17H26N2O2/c1-5-18-7-9-19(10-8-18)17(20)15-11-14(4)16(21-6-2)12-13(15)3/h11-12H,5-10H2,1-4H3 |
| InChIKey | YZDNFDAJUUCQPE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |