C15H23N3O — CID 11076232
9a-hexyl-4,5,8,9-tetrahydro-3H-imidazo[4,5-g]indolizin-7-one (PubChem CID 11076232) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 9a-hexyl-4,5,8,9-tetrahydro-3H-imidazo[4,5-g]indolizin-7-one.
| Compound Name | 9a-hexyl-4,5,8,9-tetrahydro-3H-imidazo[4,5-g]indolizin-7-one |
|---|---|
| PubChem CID | 11076232 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 9a-hexyl-4,5,8,9-tetrahydro-3H-imidazo[4,5-g]indolizin-7-one |
| SMILES | CCCCCCC12CCC(=O)N1CCc1[nH]cnc12 |
| InChI | InChI=1S/C15H23N3O/c1-2-3-4-5-8-15-9-6-13(19)18(15)10-7-12-14(15)17-11-16-12/h11H,2-10H2,1H3,(H,16,17) |
| InChIKey | UCGKNJMJNDPFKA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|