C18H21NO3 — CID 110762822
2-methoxy-N-[(2-methoxyphenyl)methyl]-3,5-dimethylbenzamide (PubChem CID 110762822) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-methoxy-N-[(2-methoxyphenyl)methyl]-3,5-dimethylbenzamide.
| Compound Name | 2-methoxy-N-[(2-methoxyphenyl)methyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 110762822 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-methoxy-N-[(2-methoxyphenyl)methyl]-3,5-dimethylbenzamide |
| SMILES | COc1ccccc1CNC(=O)c1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C18H21NO3/c1-12-9-13(2)17(22-4)15(10-12)18(20)19-11-14-7-5-6-8-16(14)21-3/h5-10H,11H2,1-4H3,(H,19,20) |
| InChIKey | NASNFOJUFROGDQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |