C13H12ClN3O2 — CID 110763000
5-chloro-2-methoxy-3-methyl-N-pyrimidin-2-ylbenzamide (PubChem CID 110763000) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-methyl-N-pyrimidin-2-ylbenzamide.
| Compound Name | 5-chloro-2-methoxy-3-methyl-N-pyrimidin-2-ylbenzamide |
|---|---|
| PubChem CID | 110763000 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-chloro-2-methoxy-3-methyl-N-pyrimidin-2-ylbenzamide |
| SMILES | COc1c(C)cc(Cl)cc1C(=O)Nc1ncccn1 |
| InChI | InChI=1S/C13H12ClN3O2/c1-8-6-9(14)7-10(11(8)19-2)12(18)17-13-15-4-3-5-16-13/h3-7H,1-2H3,(H,15,16,17,18) |
| InChIKey | LKUAPOAXHAHQAZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |