C16H21ClN2O3 — CID 110763028
1-(3-chloro-6-methoxy-2,4-dimethylbenzoyl)piperidine-4-carboxamide (PubChem CID 110763028) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-(3-chloro-6-methoxy-2,4-dimethylbenzoyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-chloro-6-methoxy-2,4-dimethylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110763028 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(3-chloro-6-methoxy-2,4-dimethylbenzoyl)piperidine-4-carboxamide |
| SMILES | COc1cc(C)c(Cl)c(C)c1C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-9-8-12(22-3)13(10(2)14(9)17)16(21)19-6-4-11(5-7-19)15(18)20/h8,11H,4-7H2,1-3H3,(H2,18,20) |
| InChIKey | AJNDRNKVVQBTSA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |