C17H28O2 — CID 11076334
3-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]propanal (PubChem CID 11076334) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]propanal.
| Compound Name | 3-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]propanal |
|---|---|
| PubChem CID | 11076334 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 3-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]propanal |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@]1(C)O[C@@H]1CCC=O |
| InChI | InChI=1S/C17H28O2/c1-14(2)8-5-9-15(3)10-6-12-17(4)16(19-17)11-7-13-18/h8,10,13,16H,5-7,9,11-12H2,1-4H3/b15-10+/t16-,17-/m1/s1 |
| InChIKey | MLUNSVMKNDPQHM-QYHCQRMFSA-N |
| XLogP | 4.60 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|