C12H10N6O2 — CID 11076488
6-(2H-tetrazol-5-yl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 11076488) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 6-(2H-tetrazol-5-yl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-(2H-tetrazol-5-yl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 11076488 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 6-(2H-tetrazol-5-yl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(CCc3cc(-c4nn[nH]n4)ccc32)N1 |
| InChI | InChI=1S/C12H10N6O2/c19-10-12(14-11(20)13-10)4-3-6-5-7(1-2-8(6)12)9-15-17-18-16-9/h1-2,5H,3-4H2,(H2,13,14,19,20)(H,15,16,17,18) |
| InChIKey | YETQIAYFFLRXOJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|