About trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate
trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate (PubChem CID 11076509) has the molecular formula C13H22O4Si
and a molecular weight of 270.40 g/mol. Its IUPAC name is trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate.
Molecular Properties
| Compound Name | trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate |
| PubChem CID | 11076509 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate |
| SMILES | CC(C)(C)C(=O)OCC#CCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H22O4Si/c1-13(2,3)12(15)16-10-8-7-9-11(14)17-18(4,5)6/h9-10H2,1-6H3 |
| InChIKey | QPOOTKNKDOBYEB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate?
The IUPAC name of trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate (CID 11076509) is trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate.
What is the SMILES notation for trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate?
The canonical SMILES for trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate is CC(C)(C)C(=O)OCC#CCC(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate?
The InChIKey is QPOOTKNKDOBYEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4Si/c1-13(2,3)12(15)16-10-8-7-9-11(14)17-18(4,5)6/h9-10H2,1-6H3.
What are the key properties of trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate?
trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate has a molecular weight of 270.40 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 5-(2,2-dimethylpropanoyloxy)pent-3-ynoate is sourced from PubChem (CID 11076509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).