C17H16N2O2 — CID 110765208
2-methyl-N-(1-phenylethyl)-1,3-benzoxazole-6-carboxamide (PubChem CID 110765208) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-methyl-N-(1-phenylethyl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-methyl-N-(1-phenylethyl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110765208 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-methyl-N-(1-phenylethyl)-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NC(C)c3ccccc3)cc2o1 |
| InChI | InChI=1S/C17H16N2O2/c1-11(13-6-4-3-5-7-13)18-17(20)14-8-9-15-16(10-14)21-12(2)19-15/h3-11H,1-2H3,(H,18,20) |
| InChIKey | CPJONGOIEJCCIU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |