C11H18N2O — CID 110766106
N-butan-2-yl-2,5-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 110766106) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-butan-2-yl-2,5-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-butan-2-yl-2,5-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 110766106 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-butan-2-yl-2,5-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(C)[nH]c1C |
| InChI | InChI=1S/C11H18N2O/c1-5-7(2)13-11(14)10-6-8(3)12-9(10)4/h6-7,12H,5H2,1-4H3,(H,13,14) |
| InChIKey | RYFUBNBIGAQULF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |