C12H10N4O4 — CID 11076614
2-(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid (PubChem CID 11076614) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid.
| Compound Name | 2-(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 11076614 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid |
| SMILES | Cn1c2ccccc2n2c(=O)c(=O)n(CC(=O)O)nc12 |
| InChI | InChI=1S/C12H10N4O4/c1-14-7-4-2-3-5-8(7)16-11(20)10(19)15(6-9(17)18)13-12(14)16/h2-5H,6H2,1H3,(H,17,18) |
| InChIKey | WYJPSCDIVLFEEC-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|