C15H17NO4 — CID 11076657
benzyl (3aR,7aS)-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate (PubChem CID 11076657) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is benzyl (3aR,7aS)-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate.
| Compound Name | benzyl (3aR,7aS)-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 11076657 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | benzyl (3aR,7aS)-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-4-carboxylate |
| SMILES | O=C1C[C@@H]2[C@H](CCCN2C(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C15H17NO4/c17-14-9-12-13(20-14)7-4-8-16(12)15(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2/t12-,13+/m1/s1 |
| InChIKey | UASSCVPHNRWPFY-OLZOCXBDSA-N |
| XLogP | 2.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |