About dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate
dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate (PubChem CID 11076676) has the molecular formula C14H12O6
and a molecular weight of 276.24 g/mol. Its IUPAC name is dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate |
| PubChem CID | 11076676 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C2Oc3ccccc3C(=O)C21 |
| InChI | InChI=1S/C14H12O6/c1-18-12(16)14(13(17)19-2)9-10(15)7-5-3-4-6-8(7)20-11(9)14/h3-6,9,11H,1-2H3 |
| InChIKey | NHVQJLZIZYGWGR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate?
The IUPAC name of dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate (CID 11076676) is dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate.
What is the SMILES notation for dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate?
The canonical SMILES for dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate is COC(=O)C1(C(=O)OC)C2Oc3ccccc3C(=O)C21.
What is the InChIKey of dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate?
The InChIKey is NHVQJLZIZYGWGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O6/c1-18-12(16)14(13(17)19-2)9-10(15)7-5-3-4-6-8(7)20-11(9)14/h3-6,9,11H,1-2H3.
What are the key properties of dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate?
dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate has a molecular weight of 276.24 g/mol, XLogP of 0.59, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 7-oxo-1a,7a-dihydrocyclopropa[b]chromene-1,1-dicarboxylate is sourced from PubChem (CID 11076676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).